C29H28ClN7OS — CID 70934078
6-[2-chloro-4-(1,3-thiazol-4-yl)phenyl]-8-ethyl-2-(3-methyl-4-piperazin-1-ylanilino)pyrido[2,3-d]pyrimidin-7-one (PubChem CID 70934078) has the molecular formula C29H28ClN7OS and a molecular weight of 558.11 g/mol. Its IUPAC name is 6-[2-chloro-4-(1,3-thiazol-4-yl)phenyl]-8-ethyl-2-(3-methyl-4-piperazin-1-ylanilino)pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 6-[2-chloro-4-(1,3-thiazol-4-yl)phenyl]-8-ethyl-2-(3-methyl-4-piperazin-1-ylanilino)pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 70934078 |
| Molecular Formula | C29H28ClN7OS |
| Molecular Weight | 558.11 g/mol |
| Exact Mass | 557.18 |
| IUPAC Name | 6-[2-chloro-4-(1,3-thiazol-4-yl)phenyl]-8-ethyl-2-(3-methyl-4-piperazin-1-ylanilino)pyrido[2,3-d]pyrimidin-7-one |
| SMILES | CCn1c(=O)c(-c2ccc(-c3cscn3)cc2Cl)cc2cnc(Nc3ccc(N4CCNCC4)c(C)c3)nc21 |
| InChI | InChI=1S/C29H28ClN7OS/c1-3-37-27-20(13-23(28(37)38)22-6-4-19(14-24(22)30)25-16-39-17-33-25)15-32-29(35-27)34-21-5-7-26(18(2)12-21)36-10-8-31-9-11-36/h4-7,12-17,31H,3,8-11H2,1-2H3,(H,32,34,35) |
| InChIKey | SFDNKBBXJFHUJT-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 87.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.11 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|