C32H48F4N4O5S — CID 70934553
tert-butyl N-[3,5-dimethyl-4-[2-[[4-oxo-2-(1,9,9,9-tetrafluorononyl)-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethyl]phenyl]-N-methylcarbamate (PubChem CID 70934553) has the molecular formula C32H48F4N4O5S and a molecular weight of 676.82 g/mol. Its IUPAC name is tert-butyl N-[3,5-dimethyl-4-[2-[[4-oxo-2-(1,9,9,9-tetrafluorononyl)-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethyl]phenyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[3,5-dimethyl-4-[2-[[4-oxo-2-(1,9,9,9-tetrafluorononyl)-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethyl]phenyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 70934553 |
| Molecular Formula | C32H48F4N4O5S |
| Molecular Weight | 676.82 g/mol |
| Exact Mass | 676.33 |
| IUPAC Name | tert-butyl N-[3,5-dimethyl-4-[2-[[4-oxo-2-(1,9,9,9-tetrafluorononyl)-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethyl]phenyl]-N-methylcarbamate |
| SMILES | Cc1cc(N(C)C(=O)OC(C)(C)C)cc(C)c1CCS(=O)(=O)N1CCC2(CC1)N=C(C(F)CCCCCCCC(F)(F)F)NC2=O |
| InChI | InChI=1S/C32H48F4N4O5S/c1-22-20-24(39(6)29(42)45-30(3,4)5)21-23(2)25(22)13-19-46(43,44)40-17-15-31(16-18-40)28(41)37-27(38-31)26(33)12-10-8-7-9-11-14-32(34,35)36/h20-21,26H,7-19H2,1-6H3,(H,37,38,41) |
| InChIKey | QGMQOEQBGGJIBA-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 108.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.82 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|