C44H35N3 — CID 70934601
3-[2,6-bis(3,5-dimethylphenyl)pyrimidin-4-yl]-6,9-diphenylcarbazole (PubChem CID 70934601) has the molecular formula C44H35N3 and a molecular weight of 605.79 g/mol. Its IUPAC name is 3-[2,6-bis(3,5-dimethylphenyl)pyrimidin-4-yl]-6,9-diphenylcarbazole.
| Compound Name | 3-[2,6-bis(3,5-dimethylphenyl)pyrimidin-4-yl]-6,9-diphenylcarbazole |
|---|---|
| PubChem CID | 70934601 |
| Molecular Formula | C44H35N3 |
| Molecular Weight | 605.79 g/mol |
| Exact Mass | 605.28 |
| IUPAC Name | 3-[2,6-bis(3,5-dimethylphenyl)pyrimidin-4-yl]-6,9-diphenylcarbazole |
| SMILES | Cc1cc(C)cc(-c2cc(-c3ccc4c(c3)c3cc(-c5ccccc5)ccc3n4-c3ccccc3)nc(-c3cc(C)cc(C)c3)n2)c1 |
| InChI | InChI=1S/C44H35N3/c1-28-19-29(2)22-35(21-28)41-27-40(45-44(46-41)36-23-30(3)20-31(4)24-36)34-16-18-43-39(26-34)38-25-33(32-11-7-5-8-12-32)15-17-42(38)47(43)37-13-9-6-10-14-37/h5-27H,1-4H3 |
| InChIKey | SEEQLWFKRSNKDZ-UHFFFAOYSA-N |
| XLogP | 11.48 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.79 |
| LogP ≤ 5 | 11.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |