C12H12F3N3O — CID 70934638
5-ethyl-N-(2,2,2-trifluoroethyl)-1H-indazole-3-carboxamide (PubChem CID 70934638) has the molecular formula C12H12F3N3O and a molecular weight of 271.24 g/mol. Its IUPAC name is 5-ethyl-N-(2,2,2-trifluoroethyl)-1H-indazole-3-carboxamide.
| Compound Name | 5-ethyl-N-(2,2,2-trifluoroethyl)-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 70934638 |
| Molecular Formula | C12H12F3N3O |
| Molecular Weight | 271.24 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | 5-ethyl-N-(2,2,2-trifluoroethyl)-1H-indazole-3-carboxamide |
| SMILES | CCc1ccc2[nH]nc(C(=O)NCC(F)(F)F)c2c1 |
| InChI | InChI=1S/C12H12F3N3O/c1-2-7-3-4-9-8(5-7)10(18-17-9)11(19)16-6-12(13,14)15/h3-5H,2,6H2,1H3,(H,16,19)(H,17,18) |
| InChIKey | NXBQBSFROQHETJ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.24 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |