C9H10F3NO — CID 70935168
2,5-dimethyl-1-(2,2,2-trifluoroethyl)pyridin-4-one (PubChem CID 70935168) has the molecular formula C9H10F3NO and a molecular weight of 205.18 g/mol. Its IUPAC name is 2,5-dimethyl-1-(2,2,2-trifluoroethyl)pyridin-4-one.
| Compound Name | 2,5-dimethyl-1-(2,2,2-trifluoroethyl)pyridin-4-one |
|---|---|
| PubChem CID | 70935168 |
| Molecular Formula | C9H10F3NO |
| Molecular Weight | 205.18 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 2,5-dimethyl-1-(2,2,2-trifluoroethyl)pyridin-4-one |
| SMILES | Cc1cn(CC(F)(F)F)c(C)cc1=O |
| InChI | InChI=1S/C9H10F3NO/c1-6-4-13(5-9(10,11)12)7(2)3-8(6)14/h3-4H,5H2,1-2H3 |
| InChIKey | CBRJOEFAKYGRJZ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.18 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |