C22H22N3O4+ — CID 7093564
(1R,3R,3aR,6aS)-5-benzyl-1-[(1R)-1-hydroxyethyl]spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3,3'-1H-indole]-2',4,6-trione (PubChem CID 7093564) has the molecular formula C22H22N3O4+ and a molecular weight of 392.44 g/mol. Its IUPAC name is (1R,3R,3aR,6aS)-5-benzyl-1-[(1R)-1-hydroxyethyl]spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3,3'-1H-indole]-2',4,6-trione.
| Compound Name | (1R,3R,3aR,6aS)-5-benzyl-1-[(1R)-1-hydroxyethyl]spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3,3'-1H-indole]-2',4,6-trione |
|---|---|
| PubChem CID | 7093564 |
| Molecular Formula | C22H22N3O4+ |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | (1R,3R,3aR,6aS)-5-benzyl-1-[(1R)-1-hydroxyethyl]spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3,3'-1H-indole]-2',4,6-trione |
| SMILES | C[C@@H](O)[C@@H]1[NH2+][C@]2(C(=O)Nc3ccccc32)[C@@H]2C(=O)N(Cc3ccccc3)C(=O)[C@H]12 |
| InChI | InChI=1S/C22H21N3O4/c1-12(26)18-16-17(20(28)25(19(16)27)11-13-7-3-2-4-8-13)22(24-18)14-9-5-6-10-15(14)23-21(22)29/h2-10,12,16-18,24,26H,11H2,1H3,(H,23,29)/p+1/t12-,16+,17+,18+,22+/m1/s1 |
| InChIKey | ZSFRKRFMTUJCFH-BVJILQTGSA-O |
| XLogP | -0.04 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|