C15H14O5S — CID 70935710
(1R,2R,6R,7S)-2-(benzenesulfonyl)-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 70935710) has the molecular formula C15H14O5S and a molecular weight of 306.34 g/mol. Its IUPAC name is (1R,2R,6R,7S)-2-(benzenesulfonyl)-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (1R,2R,6R,7S)-2-(benzenesulfonyl)-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 70935710 |
| Molecular Formula | C15H14O5S |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | (1R,2R,6R,7S)-2-(benzenesulfonyl)-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | O=C1CC(=O)[C@]2(S(=O)(=O)c3ccccc3)[C@H]3CC[C@H](O3)[C@H]12 |
| InChI | InChI=1S/C15H14O5S/c16-10-8-12(17)15(13-7-6-11(20-13)14(10)15)21(18,19)9-4-2-1-3-5-9/h1-5,11,13-14H,6-8H2/t11-,13+,14-,15-/m0/s1 |
| InChIKey | YZHQLKMJLDOWGM-ATGSNQNLSA-N |
| XLogP | 0.92 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|