About 2-(9,9-dimethylxanthen-2-yl)-9,9-dimethylxanthene
2-(9,9-dimethylxanthen-2-yl)-9,9-dimethylxanthene (PubChem CID 70935955) has the molecular formula C30H26O2
and a molecular weight of 418.54 g/mol. Its IUPAC name is 2-(9,9-dimethylxanthen-2-yl)-9,9-dimethylxanthene.
Molecular Properties
| Compound Name | 2-(9,9-dimethylxanthen-2-yl)-9,9-dimethylxanthene |
| PubChem CID | 70935955 |
| Molecular Formula | C30H26O2 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | 2-(9,9-dimethylxanthen-2-yl)-9,9-dimethylxanthene |
| SMILES | CC1(C)c2ccccc2Oc2ccc(-c3ccc4c(c3)C(C)(C)c3ccccc3O4)cc21 |
| InChI | InChI=1S/C30H26O2/c1-29(2)21-9-5-7-11-25(21)31-27-15-13-19(17-23(27)29)20-14-16-28-24(18-20)30(3,4)22-10-6-8-12-26(22)32-28/h5-18H,1-4H3 |
| InChIKey | AHYPPAGDMGKDLR-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(9,9-dimethylxanthen-2-yl)-9,9-dimethylxanthene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(9,9-dimethylxanthen-2-yl)-9,9-dimethylxanthene?
The IUPAC name of 2-(9,9-dimethylxanthen-2-yl)-9,9-dimethylxanthene (CID 70935955) is 2-(9,9-dimethylxanthen-2-yl)-9,9-dimethylxanthene.
What is the SMILES notation for 2-(9,9-dimethylxanthen-2-yl)-9,9-dimethylxanthene?
The canonical SMILES for 2-(9,9-dimethylxanthen-2-yl)-9,9-dimethylxanthene is CC1(C)c2ccccc2Oc2ccc(-c3ccc4c(c3)C(C)(C)c3ccccc3O4)cc21.
What is the InChIKey of 2-(9,9-dimethylxanthen-2-yl)-9,9-dimethylxanthene?
The InChIKey is AHYPPAGDMGKDLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H26O2/c1-29(2)21-9-5-7-11-25(21)31-27-15-13-19(17-23(27)29)20-14-16-28-24(18-20)30(3,4)22-10-6-8-12-26(22)32-28/h5-18H,1-4H3.
What are the key properties of 2-(9,9-dimethylxanthen-2-yl)-9,9-dimethylxanthene?
2-(9,9-dimethylxanthen-2-yl)-9,9-dimethylxanthene has a molecular weight of 418.54 g/mol, XLogP of 8.22, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(9,9-dimethylxanthen-2-yl)-9,9-dimethylxanthene is sourced from PubChem (CID 70935955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).