About 6-(dimethylsulfamoylamino)-2-methyl-4H-3,1-benzoxazine
6-(dimethylsulfamoylamino)-2-methyl-4H-3,1-benzoxazine (PubChem CID 70936284) has the molecular formula C11H15N3O3S
and a molecular weight of 269.33 g/mol. Its IUPAC name is 6-(dimethylsulfamoylamino)-2-methyl-4H-3,1-benzoxazine.
Molecular Properties
| Compound Name | 6-(dimethylsulfamoylamino)-2-methyl-4H-3,1-benzoxazine |
| PubChem CID | 70936284 |
| Molecular Formula | C11H15N3O3S |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 6-(dimethylsulfamoylamino)-2-methyl-4H-3,1-benzoxazine |
| SMILES | CC1=Nc2ccc(NS(=O)(=O)N(C)C)cc2CO1 |
| InChI | InChI=1S/C11H15N3O3S/c1-8-12-11-5-4-10(6-9(11)7-17-8)13-18(15,16)14(2)3/h4-6,13H,7H2,1-3H3 |
| InChIKey | QFMWEJFJFBXTED-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(dimethylsulfamoylamino)-2-methyl-4H-3,1-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(dimethylsulfamoylamino)-2-methyl-4H-3,1-benzoxazine?
The IUPAC name of 6-(dimethylsulfamoylamino)-2-methyl-4H-3,1-benzoxazine (CID 70936284) is 6-(dimethylsulfamoylamino)-2-methyl-4H-3,1-benzoxazine.
What is the SMILES notation for 6-(dimethylsulfamoylamino)-2-methyl-4H-3,1-benzoxazine?
The canonical SMILES for 6-(dimethylsulfamoylamino)-2-methyl-4H-3,1-benzoxazine is CC1=Nc2ccc(NS(=O)(=O)N(C)C)cc2CO1.
What is the InChIKey of 6-(dimethylsulfamoylamino)-2-methyl-4H-3,1-benzoxazine?
The InChIKey is QFMWEJFJFBXTED-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3O3S/c1-8-12-11-5-4-10(6-9(11)7-17-8)13-18(15,16)14(2)3/h4-6,13H,7H2,1-3H3.
What are the key properties of 6-(dimethylsulfamoylamino)-2-methyl-4H-3,1-benzoxazine?
6-(dimethylsulfamoylamino)-2-methyl-4H-3,1-benzoxazine has a molecular weight of 269.33 g/mol, XLogP of 1.49, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(dimethylsulfamoylamino)-2-methyl-4H-3,1-benzoxazine is sourced from PubChem (CID 70936284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).