C10H5Br2NOS2 — CID 70936308
4,11-dibromo-7-methyl-3,12-dithia-7-azatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,10-tetraen-8-one (PubChem CID 70936308) has the molecular formula C10H5Br2NOS2 and a molecular weight of 379.10 g/mol. Its IUPAC name is 4,11-dibromo-7-methyl-3,12-dithia-7-azatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,10-tetraen-8-one.
| Compound Name | 4,11-dibromo-7-methyl-3,12-dithia-7-azatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,10-tetraen-8-one |
|---|---|
| PubChem CID | 70936308 |
| Molecular Formula | C10H5Br2NOS2 |
| Molecular Weight | 379.10 g/mol |
| Exact Mass | 376.82 |
| IUPAC Name | 4,11-dibromo-7-methyl-3,12-dithia-7-azatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,10-tetraen-8-one |
| SMILES | Cn1c(=O)c2cc(Br)sc2c2sc(Br)cc21 |
| InChI | InChI=1S/C10H5Br2NOS2/c1-13-5-3-7(12)16-9(5)8-4(10(13)14)2-6(11)15-8/h2-3H,1H3 |
| InChIKey | HYRXLRJKMOHDTF-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.10 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |