About 2-(4-ethoxyphenyl)-5,5-dimethyl-1,3-dioxane
2-(4-ethoxyphenyl)-5,5-dimethyl-1,3-dioxane (PubChem CID 70936321) has the molecular formula C14H20O3
and a molecular weight of 236.31 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)-5,5-dimethyl-1,3-dioxane.
Molecular Properties
| Compound Name | 2-(4-ethoxyphenyl)-5,5-dimethyl-1,3-dioxane |
| PubChem CID | 70936321 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | 2-(4-ethoxyphenyl)-5,5-dimethyl-1,3-dioxane |
| SMILES | CCOc1ccc(C2OCC(C)(C)CO2)cc1 |
| InChI | InChI=1S/C14H20O3/c1-4-15-12-7-5-11(6-8-12)13-16-9-14(2,3)10-17-13/h5-8,13H,4,9-10H2,1-3H3 |
| InChIKey | IJLRYHXPAOPZDE-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-ethoxyphenyl)-5,5-dimethyl-1,3-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-ethoxyphenyl)-5,5-dimethyl-1,3-dioxane?
The IUPAC name of 2-(4-ethoxyphenyl)-5,5-dimethyl-1,3-dioxane (CID 70936321) is 2-(4-ethoxyphenyl)-5,5-dimethyl-1,3-dioxane.
What is the SMILES notation for 2-(4-ethoxyphenyl)-5,5-dimethyl-1,3-dioxane?
The canonical SMILES for 2-(4-ethoxyphenyl)-5,5-dimethyl-1,3-dioxane is CCOc1ccc(C2OCC(C)(C)CO2)cc1.
What is the InChIKey of 2-(4-ethoxyphenyl)-5,5-dimethyl-1,3-dioxane?
The InChIKey is IJLRYHXPAOPZDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O3/c1-4-15-12-7-5-11(6-8-12)13-16-9-14(2,3)10-17-13/h5-8,13H,4,9-10H2,1-3H3.
What are the key properties of 2-(4-ethoxyphenyl)-5,5-dimethyl-1,3-dioxane?
2-(4-ethoxyphenyl)-5,5-dimethyl-1,3-dioxane has a molecular weight of 236.31 g/mol, XLogP of 3.16, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-ethoxyphenyl)-5,5-dimethyl-1,3-dioxane is sourced from PubChem (CID 70936321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).