C60H40N4 — CID 70936394
2,4-bis[4-(4,6-diphenyl-2-pyridinyl)phenyl]-6-naphthalen-2-ylpyrimidine (PubChem CID 70936394) has the molecular formula C60H40N4 and a molecular weight of 817.01 g/mol. Its IUPAC name is 2,4-bis[4-(4,6-diphenyl-2-pyridinyl)phenyl]-6-naphthalen-2-ylpyrimidine.
| Compound Name | 2,4-bis[4-(4,6-diphenyl-2-pyridinyl)phenyl]-6-naphthalen-2-ylpyrimidine |
|---|---|
| PubChem CID | 70936394 |
| Molecular Formula | C60H40N4 |
| Molecular Weight | 817.01 g/mol |
| Exact Mass | 816.33 |
| IUPAC Name | 2,4-bis[4-(4,6-diphenyl-2-pyridinyl)phenyl]-6-naphthalen-2-ylpyrimidine |
| SMILES | c1ccc(-c2cc(-c3ccccc3)nc(-c3ccc(-c4cc(-c5ccc6ccccc6c5)nc(-c5ccc(-c6cc(-c7ccccc7)cc(-c7ccccc7)n6)cc5)n4)cc3)c2)cc1 |
| InChI | InChI=1S/C60H40N4/c1-5-15-41(16-6-1)52-36-54(44-20-9-3-10-21-44)61-56(38-52)46-26-28-48(29-27-46)58-40-59(51-34-25-43-19-13-14-24-50(43)35-51)64-60(63-58)49-32-30-47(31-33-49)57-39-53(42-17-7-2-8-18-42)37-55(62-57)45-22-11-4-12-23-45/h1-40H |
| InChIKey | QMAAMHMOFCGUJQ-UHFFFAOYSA-N |
| XLogP | 15.42 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.01 |
| LogP ≤ 5 | 15.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |