About 4-(2-methylpropyl)-1,4-diazatricyclo[4.3.1.13,8]undecane
4-(2-methylpropyl)-1,4-diazatricyclo[4.3.1.13,8]undecane (PubChem CID 70936465) has the molecular formula C13H24N2
and a molecular weight of 208.35 g/mol. Its IUPAC name is 4-(2-methylpropyl)-1,4-diazatricyclo[4.3.1.13,8]undecane.
Molecular Properties
| Compound Name | 4-(2-methylpropyl)-1,4-diazatricyclo[4.3.1.13,8]undecane |
| PubChem CID | 70936465 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | 4-(2-methylpropyl)-1,4-diazatricyclo[4.3.1.13,8]undecane |
| SMILES | CC(C)CN1CC2CC3CC1CN(C3)C2 |
| InChI | InChI=1S/C13H24N2/c1-10(2)5-15-8-12-3-11-4-13(15)9-14(6-11)7-12/h10-13H,3-9H2,1-2H3 |
| InChIKey | OYGXGAYYXNQXSH-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(2-methylpropyl)-1,4-diazatricyclo[4.3.1.13,8]undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-methylpropyl)-1,4-diazatricyclo[4.3.1.13,8]undecane?
The IUPAC name of 4-(2-methylpropyl)-1,4-diazatricyclo[4.3.1.13,8]undecane (CID 70936465) is 4-(2-methylpropyl)-1,4-diazatricyclo[4.3.1.13,8]undecane.
What is the SMILES notation for 4-(2-methylpropyl)-1,4-diazatricyclo[4.3.1.13,8]undecane?
The canonical SMILES for 4-(2-methylpropyl)-1,4-diazatricyclo[4.3.1.13,8]undecane is CC(C)CN1CC2CC3CC1CN(C3)C2.
What is the InChIKey of 4-(2-methylpropyl)-1,4-diazatricyclo[4.3.1.13,8]undecane?
The InChIKey is OYGXGAYYXNQXSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N2/c1-10(2)5-15-8-12-3-11-4-13(15)9-14(6-11)7-12/h10-13H,3-9H2,1-2H3.
What are the key properties of 4-(2-methylpropyl)-1,4-diazatricyclo[4.3.1.13,8]undecane?
4-(2-methylpropyl)-1,4-diazatricyclo[4.3.1.13,8]undecane has a molecular weight of 208.35 g/mol, XLogP of 1.67, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methylpropyl)-1,4-diazatricyclo[4.3.1.13,8]undecane is sourced from PubChem (CID 70936465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).