C21H24O4P2 — CID 70936627
(1S,2S,10R,14R)-11,11,13,13-tetramethyl-3,21-dioxa-10λ5,14λ5-diphosphapentacyclo[12.7.0.02,10.04,9.015,20]henicosa-4,6,8,15,17,19-hexaene 10,14-dioxide (PubChem CID 70936627) has the molecular formula C21H24O4P2 and a molecular weight of 402.37 g/mol. Its IUPAC name is (1S,2S,10R,14R)-11,11,13,13-tetramethyl-3,21-dioxa-10λ5,14λ5-diphosphapentacyclo[12.7.0.02,10.04,9.015,20]henicosa-4,6,8,15,17,19-hexaene 10,14-dioxide.
| Compound Name | (1S,2S,10R,14R)-11,11,13,13-tetramethyl-3,21-dioxa-10λ5,14λ5-diphosphapentacyclo[12.7.0.02,10.04,9.015,20]henicosa-4,6,8,15,17,19-hexaene 10,14-dioxide |
|---|---|
| PubChem CID | 70936627 |
| Molecular Formula | C21H24O4P2 |
| Molecular Weight | 402.37 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | (1S,2S,10R,14R)-11,11,13,13-tetramethyl-3,21-dioxa-10λ5,14λ5-diphosphapentacyclo[12.7.0.02,10.04,9.015,20]henicosa-4,6,8,15,17,19-hexaene 10,14-dioxide |
| SMILES | CC1(C)CC(C)(C)[P@@]2(=O)c3ccccc3O[C@@H]2[C@H]2Oc3ccccc3[P@@]21=O |
| InChI | InChI=1S/C21H24O4P2/c1-20(2)13-21(3,4)27(23)17-12-8-6-10-15(17)25-19(27)18-24-14-9-5-7-11-16(14)26(18,20)22/h5-12,18-19H,13H2,1-4H3/t18-,19-,26+,27+/m0/s1 |
| InChIKey | YMNYNNZIPZOKLR-CPAHJZNRSA-N |
| XLogP | 4.76 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.37 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|