C19H18N2O3 — CID 70937381
5,7-dimethoxy-N-phenyl-3,9a-dihydrochromeno[2,3-b]pyrrol-2-amine (PubChem CID 70937381) has the molecular formula C19H18N2O3 and a molecular weight of 322.36 g/mol. Its IUPAC name is 5,7-dimethoxy-N-phenyl-3,9a-dihydrochromeno[2,3-b]pyrrol-2-amine.
| Compound Name | 5,7-dimethoxy-N-phenyl-3,9a-dihydrochromeno[2,3-b]pyrrol-2-amine |
|---|---|
| PubChem CID | 70937381 |
| Molecular Formula | C19H18N2O3 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | 5,7-dimethoxy-N-phenyl-3,9a-dihydrochromeno[2,3-b]pyrrol-2-amine |
| SMILES | COc1cc(OC)c2c(c1)OC1N=C(Nc3ccccc3)CC1=C2 |
| InChI | InChI=1S/C19H18N2O3/c1-22-14-10-16(23-2)15-8-12-9-18(20-13-6-4-3-5-7-13)21-19(12)24-17(15)11-14/h3-8,10-11,19H,9H2,1-2H3,(H,20,21) |
| InChIKey | QGARVSHLANNSHF-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 52.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |