About 2,7-dimethyl-8H-pyrrolo[3,2-g][1,3]benzothiazole
2,7-dimethyl-8H-pyrrolo[3,2-g][1,3]benzothiazole (PubChem CID 70937598) has the molecular formula C11H10N2S
and a molecular weight of 202.28 g/mol. Its IUPAC name is 2,7-dimethyl-8H-pyrrolo[3,2-g][1,3]benzothiazole.
Molecular Properties
| Compound Name | 2,7-dimethyl-8H-pyrrolo[3,2-g][1,3]benzothiazole |
| PubChem CID | 70937598 |
| Molecular Formula | C11H10N2S |
| Molecular Weight | 202.28 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | 2,7-dimethyl-8H-pyrrolo[3,2-g][1,3]benzothiazole |
| SMILES | Cc1cc2ccc3nc(C)sc3c2[nH]1 |
| InChI | InChI=1S/C11H10N2S/c1-6-5-8-3-4-9-11(10(8)12-6)14-7(2)13-9/h3-5,12H,1-2H3 |
| InChIKey | LWYYSPYYSOIUFM-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.28 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,7-dimethyl-8H-pyrrolo[3,2-g][1,3]benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-dimethyl-8H-pyrrolo[3,2-g][1,3]benzothiazole?
The IUPAC name of 2,7-dimethyl-8H-pyrrolo[3,2-g][1,3]benzothiazole (CID 70937598) is 2,7-dimethyl-8H-pyrrolo[3,2-g][1,3]benzothiazole.
What is the SMILES notation for 2,7-dimethyl-8H-pyrrolo[3,2-g][1,3]benzothiazole?
The canonical SMILES for 2,7-dimethyl-8H-pyrrolo[3,2-g][1,3]benzothiazole is Cc1cc2ccc3nc(C)sc3c2[nH]1.
What is the InChIKey of 2,7-dimethyl-8H-pyrrolo[3,2-g][1,3]benzothiazole?
The InChIKey is LWYYSPYYSOIUFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2S/c1-6-5-8-3-4-9-11(10(8)12-6)14-7(2)13-9/h3-5,12H,1-2H3.
What are the key properties of 2,7-dimethyl-8H-pyrrolo[3,2-g][1,3]benzothiazole?
2,7-dimethyl-8H-pyrrolo[3,2-g][1,3]benzothiazole has a molecular weight of 202.28 g/mol, XLogP of 3.39, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-dimethyl-8H-pyrrolo[3,2-g][1,3]benzothiazole is sourced from PubChem (CID 70937598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).