About 7-methyl-2-propan-2-yl-6H-imidazo[4,5-g][1,3]benzothiazole
7-methyl-2-propan-2-yl-6H-imidazo[4,5-g][1,3]benzothiazole (PubChem CID 70937639) has the molecular formula C12H13N3S
and a molecular weight of 231.32 g/mol. Its IUPAC name is 7-methyl-2-propan-2-yl-6H-imidazo[4,5-g][1,3]benzothiazole.
Molecular Properties
| Compound Name | 7-methyl-2-propan-2-yl-6H-imidazo[4,5-g][1,3]benzothiazole |
| PubChem CID | 70937639 |
| Molecular Formula | C12H13N3S |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | 7-methyl-2-propan-2-yl-6H-imidazo[4,5-g][1,3]benzothiazole |
| SMILES | Cc1nc2c(ccc3nc(C(C)C)sc32)[nH]1 |
| InChI | InChI=1S/C12H13N3S/c1-6(2)12-15-9-5-4-8-10(11(9)16-12)14-7(3)13-8/h4-6H,1-3H3,(H,13,14) |
| InChIKey | FYUOIDANDDKXAA-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-methyl-2-propan-2-yl-6H-imidazo[4,5-g][1,3]benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-2-propan-2-yl-6H-imidazo[4,5-g][1,3]benzothiazole?
The IUPAC name of 7-methyl-2-propan-2-yl-6H-imidazo[4,5-g][1,3]benzothiazole (CID 70937639) is 7-methyl-2-propan-2-yl-6H-imidazo[4,5-g][1,3]benzothiazole.
What is the SMILES notation for 7-methyl-2-propan-2-yl-6H-imidazo[4,5-g][1,3]benzothiazole?
The canonical SMILES for 7-methyl-2-propan-2-yl-6H-imidazo[4,5-g][1,3]benzothiazole is Cc1nc2c(ccc3nc(C(C)C)sc32)[nH]1.
What is the InChIKey of 7-methyl-2-propan-2-yl-6H-imidazo[4,5-g][1,3]benzothiazole?
The InChIKey is FYUOIDANDDKXAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N3S/c1-6(2)12-15-9-5-4-8-10(11(9)16-12)14-7(3)13-8/h4-6H,1-3H3,(H,13,14).
What are the key properties of 7-methyl-2-propan-2-yl-6H-imidazo[4,5-g][1,3]benzothiazole?
7-methyl-2-propan-2-yl-6H-imidazo[4,5-g][1,3]benzothiazole has a molecular weight of 231.32 g/mol, XLogP of 3.60, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-2-propan-2-yl-6H-imidazo[4,5-g][1,3]benzothiazole is sourced from PubChem (CID 70937639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).