About 2-methyl-7-propan-2-yl-1H-pyrrolo[2,3-f]quinoline
2-methyl-7-propan-2-yl-1H-pyrrolo[2,3-f]quinoline (PubChem CID 70937650) has the molecular formula C15H16N2
and a molecular weight of 224.31 g/mol. Its IUPAC name is 2-methyl-7-propan-2-yl-1H-pyrrolo[2,3-f]quinoline.
Molecular Properties
| Compound Name | 2-methyl-7-propan-2-yl-1H-pyrrolo[2,3-f]quinoline |
| PubChem CID | 70937650 |
| Molecular Formula | C15H16N2 |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 2-methyl-7-propan-2-yl-1H-pyrrolo[2,3-f]quinoline |
| SMILES | Cc1cc2ccc3nc(C(C)C)ccc3c2[nH]1 |
| InChI | InChI=1S/C15H16N2/c1-9(2)13-7-5-12-14(17-13)6-4-11-8-10(3)16-15(11)12/h4-9,16H,1-3H3 |
| InChIKey | RBTRDRXYYOWHBK-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methyl-7-propan-2-yl-1H-pyrrolo[2,3-f]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-7-propan-2-yl-1H-pyrrolo[2,3-f]quinoline?
The IUPAC name of 2-methyl-7-propan-2-yl-1H-pyrrolo[2,3-f]quinoline (CID 70937650) is 2-methyl-7-propan-2-yl-1H-pyrrolo[2,3-f]quinoline.
What is the SMILES notation for 2-methyl-7-propan-2-yl-1H-pyrrolo[2,3-f]quinoline?
The canonical SMILES for 2-methyl-7-propan-2-yl-1H-pyrrolo[2,3-f]quinoline is Cc1cc2ccc3nc(C(C)C)ccc3c2[nH]1.
What is the InChIKey of 2-methyl-7-propan-2-yl-1H-pyrrolo[2,3-f]quinoline?
The InChIKey is RBTRDRXYYOWHBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N2/c1-9(2)13-7-5-12-14(17-13)6-4-11-8-10(3)16-15(11)12/h4-9,16H,1-3H3.
What are the key properties of 2-methyl-7-propan-2-yl-1H-pyrrolo[2,3-f]quinoline?
2-methyl-7-propan-2-yl-1H-pyrrolo[2,3-f]quinoline has a molecular weight of 224.31 g/mol, XLogP of 4.15, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-7-propan-2-yl-1H-pyrrolo[2,3-f]quinoline is sourced from PubChem (CID 70937650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).