About 2-methyl-7-propan-2-yl-8H-thieno[3,2-g]indole
2-methyl-7-propan-2-yl-8H-thieno[3,2-g]indole (PubChem CID 70937708) has the molecular formula C14H15NS
and a molecular weight of 229.35 g/mol. Its IUPAC name is 2-methyl-7-propan-2-yl-8H-thieno[3,2-g]indole.
Molecular Properties
| Compound Name | 2-methyl-7-propan-2-yl-8H-thieno[3,2-g]indole |
| PubChem CID | 70937708 |
| Molecular Formula | C14H15NS |
| Molecular Weight | 229.35 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 2-methyl-7-propan-2-yl-8H-thieno[3,2-g]indole |
| SMILES | Cc1cc2ccc3cc(C(C)C)[nH]c3c2s1 |
| InChI | InChI=1S/C14H15NS/c1-8(2)12-7-10-4-5-11-6-9(3)16-14(11)13(10)15-12/h4-8,15H,1-3H3 |
| InChIKey | WJNGQBLYKGTENI-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.35 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methyl-7-propan-2-yl-8H-thieno[3,2-g]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-7-propan-2-yl-8H-thieno[3,2-g]indole?
The IUPAC name of 2-methyl-7-propan-2-yl-8H-thieno[3,2-g]indole (CID 70937708) is 2-methyl-7-propan-2-yl-8H-thieno[3,2-g]indole.
What is the SMILES notation for 2-methyl-7-propan-2-yl-8H-thieno[3,2-g]indole?
The canonical SMILES for 2-methyl-7-propan-2-yl-8H-thieno[3,2-g]indole is Cc1cc2ccc3cc(C(C)C)[nH]c3c2s1.
What is the InChIKey of 2-methyl-7-propan-2-yl-8H-thieno[3,2-g]indole?
The InChIKey is WJNGQBLYKGTENI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NS/c1-8(2)12-7-10-4-5-11-6-9(3)16-14(11)13(10)15-12/h4-8,15H,1-3H3.
What are the key properties of 2-methyl-7-propan-2-yl-8H-thieno[3,2-g]indole?
2-methyl-7-propan-2-yl-8H-thieno[3,2-g]indole has a molecular weight of 229.35 g/mol, XLogP of 4.81, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-7-propan-2-yl-8H-thieno[3,2-g]indole is sourced from PubChem (CID 70937708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).