C13H17Cl2N3O — CID 70937800
(5,5-dichloro-1,4,6,7-tetrahydroindol-2-yl)-piperazin-1-ylmethanone (PubChem CID 70937800) has the molecular formula C13H17Cl2N3O and a molecular weight of 302.21 g/mol. Its IUPAC name is (5,5-dichloro-1,4,6,7-tetrahydroindol-2-yl)-piperazin-1-ylmethanone.
| Compound Name | (5,5-dichloro-1,4,6,7-tetrahydroindol-2-yl)-piperazin-1-ylmethanone |
|---|---|
| PubChem CID | 70937800 |
| Molecular Formula | C13H17Cl2N3O |
| Molecular Weight | 302.21 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | (5,5-dichloro-1,4,6,7-tetrahydroindol-2-yl)-piperazin-1-ylmethanone |
| SMILES | O=C(c1cc2c([nH]1)CCC(Cl)(Cl)C2)N1CCNCC1 |
| InChI | InChI=1S/C13H17Cl2N3O/c14-13(15)2-1-10-9(8-13)7-11(17-10)12(19)18-5-3-16-4-6-18/h7,16-17H,1-6,8H2 |
| InChIKey | ZVUBXIMINJBNQG-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.21 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|