C16H21F2N3O2 — CID 70937812
[(4aR,7aR)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl]-(5,5-difluoro-4-hydroxy-1,4,6,7-tetrahydroindol-2-yl)methanone (PubChem CID 70937812) has the molecular formula C16H21F2N3O2 and a molecular weight of 325.36 g/mol. Its IUPAC name is [(4aR,7aR)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl]-(5,5-difluoro-4-hydroxy-1,4,6,7-tetrahydroindol-2-yl)methanone.
| Compound Name | [(4aR,7aR)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl]-(5,5-difluoro-4-hydroxy-1,4,6,7-tetrahydroindol-2-yl)methanone |
|---|---|
| PubChem CID | 70937812 |
| Molecular Formula | C16H21F2N3O2 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | [(4aR,7aR)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl]-(5,5-difluoro-4-hydroxy-1,4,6,7-tetrahydroindol-2-yl)methanone |
| SMILES | O=C(c1cc2c([nH]1)CCC(F)(F)C2O)N1C[C@H]2CCCN[C@H]2C1 |
| InChI | InChI=1S/C16H21F2N3O2/c17-16(18)4-3-11-10(14(16)22)6-12(20-11)15(23)21-7-9-2-1-5-19-13(9)8-21/h6,9,13-14,19-20,22H,1-5,7-8H2/t9-,13+,14?/m1/s1 |
| InChIKey | FJQSDEYPSRDVMO-YBOKSBOGSA-N |
| XLogP | 1.45 |
| TPSA | 68.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |