C17H17N3O2 — CID 70937887
1,2-dibenzyl-4-methyl-1,2,4-triazolidine-3,5-dione (PubChem CID 70937887) has the molecular formula C17H17N3O2 and a molecular weight of 295.34 g/mol. Its IUPAC name is 1,2-dibenzyl-4-methyl-1,2,4-triazolidine-3,5-dione.
| Compound Name | 1,2-dibenzyl-4-methyl-1,2,4-triazolidine-3,5-dione |
|---|---|
| PubChem CID | 70937887 |
| Molecular Formula | C17H17N3O2 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | 1,2-dibenzyl-4-methyl-1,2,4-triazolidine-3,5-dione |
| SMILES | Cn1c(=O)n(Cc2ccccc2)n(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C17H17N3O2/c1-18-16(21)19(12-14-8-4-2-5-9-14)20(17(18)22)13-15-10-6-3-7-11-15/h2-11H,12-13H2,1H3 |
| InChIKey | FDPLGCUBKXAOTC-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 48.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |