C17H19F3N4O2S2 — CID 70937923
(3S,5R)-5-(2-methylsulfonyl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl)-2-(2,3,5-trifluorophenyl)thian-3-amine (PubChem CID 70937923) has the molecular formula C17H19F3N4O2S2 and a molecular weight of 432.49 g/mol. Its IUPAC name is (3S,5R)-5-(2-methylsulfonyl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl)-2-(2,3,5-trifluorophenyl)thian-3-amine.
| Compound Name | (3S,5R)-5-(2-methylsulfonyl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl)-2-(2,3,5-trifluorophenyl)thian-3-amine |
|---|---|
| PubChem CID | 70937923 |
| Molecular Formula | C17H19F3N4O2S2 |
| Molecular Weight | 432.49 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | (3S,5R)-5-(2-methylsulfonyl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl)-2-(2,3,5-trifluorophenyl)thian-3-amine |
| SMILES | CS(=O)(=O)n1cc2c(n1)CN([C@H]1CSC(c3cc(F)cc(F)c3F)[C@@H](N)C1)C2 |
| InChI | InChI=1S/C17H19F3N4O2S2/c1-28(25,26)24-6-9-5-23(7-15(9)22-24)11-4-14(21)17(27-8-11)12-2-10(18)3-13(19)16(12)20/h2-3,6,11,14,17H,4-5,7-8,21H2,1H3/t11-,14+,17?/m1/s1 |
| InChIKey | WOAQTPZMMMSKNP-JJNQEZICSA-N |
| XLogP | 2.00 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.49 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|