About methyl 2-(5-tert-butyl-4,6-dihydropyrrolo[3,4-c]pyrazol-2-yl)acetate
methyl 2-(5-tert-butyl-4,6-dihydropyrrolo[3,4-c]pyrazol-2-yl)acetate (PubChem CID 70937957) has the molecular formula C12H19N3O2
and a molecular weight of 237.30 g/mol. Its IUPAC name is methyl 2-(5-tert-butyl-4,6-dihydropyrrolo[3,4-c]pyrazol-2-yl)acetate.
Molecular Properties
| Compound Name | methyl 2-(5-tert-butyl-4,6-dihydropyrrolo[3,4-c]pyrazol-2-yl)acetate |
| PubChem CID | 70937957 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | methyl 2-(5-tert-butyl-4,6-dihydropyrrolo[3,4-c]pyrazol-2-yl)acetate |
| SMILES | COC(=O)Cn1cc2c(n1)CN(C(C)(C)C)C2 |
| InChI | InChI=1S/C12H19N3O2/c1-12(2,3)14-5-9-6-15(8-11(16)17-4)13-10(9)7-14/h6H,5,7-8H2,1-4H3 |
| InChIKey | MYYWCGANWVQELF-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-(5-tert-butyl-4,6-dihydropyrrolo[3,4-c]pyrazol-2-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(5-tert-butyl-4,6-dihydropyrrolo[3,4-c]pyrazol-2-yl)acetate?
The IUPAC name of methyl 2-(5-tert-butyl-4,6-dihydropyrrolo[3,4-c]pyrazol-2-yl)acetate (CID 70937957) is methyl 2-(5-tert-butyl-4,6-dihydropyrrolo[3,4-c]pyrazol-2-yl)acetate.
What is the SMILES notation for methyl 2-(5-tert-butyl-4,6-dihydropyrrolo[3,4-c]pyrazol-2-yl)acetate?
The canonical SMILES for methyl 2-(5-tert-butyl-4,6-dihydropyrrolo[3,4-c]pyrazol-2-yl)acetate is COC(=O)Cn1cc2c(n1)CN(C(C)(C)C)C2.
What is the InChIKey of methyl 2-(5-tert-butyl-4,6-dihydropyrrolo[3,4-c]pyrazol-2-yl)acetate?
The InChIKey is MYYWCGANWVQELF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3O2/c1-12(2,3)14-5-9-6-15(8-11(16)17-4)13-10(9)7-14/h6H,5,7-8H2,1-4H3.
What are the key properties of methyl 2-(5-tert-butyl-4,6-dihydropyrrolo[3,4-c]pyrazol-2-yl)acetate?
methyl 2-(5-tert-butyl-4,6-dihydropyrrolo[3,4-c]pyrazol-2-yl)acetate has a molecular weight of 237.30 g/mol, XLogP of 1.17, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(5-tert-butyl-4,6-dihydropyrrolo[3,4-c]pyrazol-2-yl)acetate is sourced from PubChem (CID 70937957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).