About N-[5-[2-(2,6-dimethylmorpholin-4-yl)-4-fluoroanilino]pentyl]propane-2-sulfonamide
N-[5-[2-(2,6-dimethylmorpholin-4-yl)-4-fluoroanilino]pentyl]propane-2-sulfonamide (PubChem CID 70938900) has the molecular formula C20H34FN3O3S
and a molecular weight of 415.58 g/mol. Its IUPAC name is N-[5-[2-(2,6-dimethylmorpholin-4-yl)-4-fluoroanilino]pentyl]propane-2-sulfonamide.
Molecular Properties
| Compound Name | N-[5-[2-(2,6-dimethylmorpholin-4-yl)-4-fluoroanilino]pentyl]propane-2-sulfonamide |
| PubChem CID | 70938900 |
| Molecular Formula | C20H34FN3O3S |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | N-[5-[2-(2,6-dimethylmorpholin-4-yl)-4-fluoroanilino]pentyl]propane-2-sulfonamide |
| SMILES | CC1CN(c2cc(F)ccc2NCCCCCNS(=O)(=O)C(C)C)CC(C)O1 |
| InChI | InChI=1S/C20H34FN3O3S/c1-15(2)28(25,26)23-11-7-5-6-10-22-19-9-8-18(21)12-20(19)24-13-16(3)27-17(4)14-24/h8-9,12,15-17,22-23H,5-7,10-11,13-14H2,1-4H3 |
| InChIKey | QVGMJYNQPYPXKJ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[5-[2-(2,6-dimethylmorpholin-4-yl)-4-fluoroanilino]pentyl]propane-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-[2-(2,6-dimethylmorpholin-4-yl)-4-fluoroanilino]pentyl]propane-2-sulfonamide?
The IUPAC name of N-[5-[2-(2,6-dimethylmorpholin-4-yl)-4-fluoroanilino]pentyl]propane-2-sulfonamide (CID 70938900) is N-[5-[2-(2,6-dimethylmorpholin-4-yl)-4-fluoroanilino]pentyl]propane-2-sulfonamide.
What is the SMILES notation for N-[5-[2-(2,6-dimethylmorpholin-4-yl)-4-fluoroanilino]pentyl]propane-2-sulfonamide?
The canonical SMILES for N-[5-[2-(2,6-dimethylmorpholin-4-yl)-4-fluoroanilino]pentyl]propane-2-sulfonamide is CC1CN(c2cc(F)ccc2NCCCCCNS(=O)(=O)C(C)C)CC(C)O1.
What is the InChIKey of N-[5-[2-(2,6-dimethylmorpholin-4-yl)-4-fluoroanilino]pentyl]propane-2-sulfonamide?
The InChIKey is QVGMJYNQPYPXKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H34FN3O3S/c1-15(2)28(25,26)23-11-7-5-6-10-22-19-9-8-18(21)12-20(19)24-13-16(3)27-17(4)14-24/h8-9,12,15-17,22-23H,5-7,10-11,13-14H2,1-4H3.
What are the key properties of N-[5-[2-(2,6-dimethylmorpholin-4-yl)-4-fluoroanilino]pentyl]propane-2-sulfonamide?
N-[5-[2-(2,6-dimethylmorpholin-4-yl)-4-fluoroanilino]pentyl]propane-2-sulfonamide has a molecular weight of 415.58 g/mol, XLogP of 3.35, 10 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-[2-(2,6-dimethylmorpholin-4-yl)-4-fluoroanilino]pentyl]propane-2-sulfonamide is sourced from PubChem (CID 70938900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).