C23H38FN3O3S — CID 70938972
N-[4-[[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-3-fluoroanilino]methyl]cyclohexyl]-2-methylpropane-2-sulfonamide (PubChem CID 70938972) has the molecular formula C23H38FN3O3S and a molecular weight of 455.64 g/mol. Its IUPAC name is N-[4-[[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-3-fluoroanilino]methyl]cyclohexyl]-2-methylpropane-2-sulfonamide.
| Compound Name | N-[4-[[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-3-fluoroanilino]methyl]cyclohexyl]-2-methylpropane-2-sulfonamide |
|---|---|
| PubChem CID | 70938972 |
| Molecular Formula | C23H38FN3O3S |
| Molecular Weight | 455.64 g/mol |
| Exact Mass | 455.26 |
| IUPAC Name | N-[4-[[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-3-fluoroanilino]methyl]cyclohexyl]-2-methylpropane-2-sulfonamide |
| SMILES | C[C@@H]1CN(c2ccc(NCC3CCC(NS(=O)(=O)C(C)(C)C)CC3)cc2F)C[C@H](C)O1 |
| InChI | InChI=1S/C23H38FN3O3S/c1-16-14-27(15-17(2)30-16)22-11-10-20(12-21(22)24)25-13-18-6-8-19(9-7-18)26-31(28,29)23(3,4)5/h10-12,16-19,25-26H,6-9,13-15H2,1-5H3/t16-,17+,18?,19? |
| InChIKey | KUBZGNZMFKFFHW-LPOKXYRGSA-N |
| XLogP | 4.13 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.64 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|