About N-[4-[[4-(3,5-dimethylcyclohexyl)anilino]methyl]cyclohexyl]propane-2-sulfonamide
N-[4-[[4-(3,5-dimethylcyclohexyl)anilino]methyl]cyclohexyl]propane-2-sulfonamide (PubChem CID 70939085) has the molecular formula C24H40N2O2S
and a molecular weight of 420.66 g/mol. Its IUPAC name is N-[4-[[4-(3,5-dimethylcyclohexyl)anilino]methyl]cyclohexyl]propane-2-sulfonamide.
Molecular Properties
| Compound Name | N-[4-[[4-(3,5-dimethylcyclohexyl)anilino]methyl]cyclohexyl]propane-2-sulfonamide |
| PubChem CID | 70939085 |
| Molecular Formula | C24H40N2O2S |
| Molecular Weight | 420.66 g/mol |
| Exact Mass | 420.28 |
| IUPAC Name | N-[4-[[4-(3,5-dimethylcyclohexyl)anilino]methyl]cyclohexyl]propane-2-sulfonamide |
| SMILES | CC1CC(C)CC(c2ccc(NCC3CCC(NS(=O)(=O)C(C)C)CC3)cc2)C1 |
| InChI | InChI=1S/C24H40N2O2S/c1-17(2)29(27,28)26-24-9-5-20(6-10-24)16-25-23-11-7-21(8-12-23)22-14-18(3)13-19(4)15-22/h7-8,11-12,17-20,22,24-26H,5-6,9-10,13-16H2,1-4H3 |
| InChIKey | BEMXDHNMYYCJHS-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 420.66 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[4-[[4-(3,5-dimethylcyclohexyl)anilino]methyl]cyclohexyl]propane-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[[4-(3,5-dimethylcyclohexyl)anilino]methyl]cyclohexyl]propane-2-sulfonamide?
The IUPAC name of N-[4-[[4-(3,5-dimethylcyclohexyl)anilino]methyl]cyclohexyl]propane-2-sulfonamide (CID 70939085) is N-[4-[[4-(3,5-dimethylcyclohexyl)anilino]methyl]cyclohexyl]propane-2-sulfonamide.
What is the SMILES notation for N-[4-[[4-(3,5-dimethylcyclohexyl)anilino]methyl]cyclohexyl]propane-2-sulfonamide?
The canonical SMILES for N-[4-[[4-(3,5-dimethylcyclohexyl)anilino]methyl]cyclohexyl]propane-2-sulfonamide is CC1CC(C)CC(c2ccc(NCC3CCC(NS(=O)(=O)C(C)C)CC3)cc2)C1.
What is the InChIKey of N-[4-[[4-(3,5-dimethylcyclohexyl)anilino]methyl]cyclohexyl]propane-2-sulfonamide?
The InChIKey is BEMXDHNMYYCJHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H40N2O2S/c1-17(2)29(27,28)26-24-9-5-20(6-10-24)16-25-23-11-7-21(8-12-23)22-14-18(3)13-19(4)15-22/h7-8,11-12,17-20,22,24-26H,5-6,9-10,13-16H2,1-4H3.
What are the key properties of N-[4-[[4-(3,5-dimethylcyclohexyl)anilino]methyl]cyclohexyl]propane-2-sulfonamide?
N-[4-[[4-(3,5-dimethylcyclohexyl)anilino]methyl]cyclohexyl]propane-2-sulfonamide has a molecular weight of 420.66 g/mol, XLogP of 5.52, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[[4-(3,5-dimethylcyclohexyl)anilino]methyl]cyclohexyl]propane-2-sulfonamide is sourced from PubChem (CID 70939085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).