About N-[5-[(1,7-dimethyl-2,3-dihydro-1H-inden-5-yl)amino]pentyl]-2-methylpropane-2-sulfonamide
N-[5-[(1,7-dimethyl-2,3-dihydro-1H-inden-5-yl)amino]pentyl]-2-methylpropane-2-sulfonamide (PubChem CID 70939258) has the molecular formula C20H34N2O2S
and a molecular weight of 366.57 g/mol. Its IUPAC name is N-[5-[(1,7-dimethyl-2,3-dihydro-1H-inden-5-yl)amino]pentyl]-2-methylpropane-2-sulfonamide.
Molecular Properties
| Compound Name | N-[5-[(1,7-dimethyl-2,3-dihydro-1H-inden-5-yl)amino]pentyl]-2-methylpropane-2-sulfonamide |
| PubChem CID | 70939258 |
| Molecular Formula | C20H34N2O2S |
| Molecular Weight | 366.57 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | N-[5-[(1,7-dimethyl-2,3-dihydro-1H-inden-5-yl)amino]pentyl]-2-methylpropane-2-sulfonamide |
| SMILES | Cc1cc(NCCCCCNS(=O)(=O)C(C)(C)C)cc2c1C(C)CC2 |
| InChI | InChI=1S/C20H34N2O2S/c1-15-9-10-17-14-18(13-16(2)19(15)17)21-11-7-6-8-12-22-25(23,24)20(3,4)5/h13-15,21-22H,6-12H2,1-5H3 |
| InChIKey | MCUPTWISUGZLRD-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.57 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[5-[(1,7-dimethyl-2,3-dihydro-1H-inden-5-yl)amino]pentyl]-2-methylpropane-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-[(1,7-dimethyl-2,3-dihydro-1H-inden-5-yl)amino]pentyl]-2-methylpropane-2-sulfonamide?
The IUPAC name of N-[5-[(1,7-dimethyl-2,3-dihydro-1H-inden-5-yl)amino]pentyl]-2-methylpropane-2-sulfonamide (CID 70939258) is N-[5-[(1,7-dimethyl-2,3-dihydro-1H-inden-5-yl)amino]pentyl]-2-methylpropane-2-sulfonamide.
What is the SMILES notation for N-[5-[(1,7-dimethyl-2,3-dihydro-1H-inden-5-yl)amino]pentyl]-2-methylpropane-2-sulfonamide?
The canonical SMILES for N-[5-[(1,7-dimethyl-2,3-dihydro-1H-inden-5-yl)amino]pentyl]-2-methylpropane-2-sulfonamide is Cc1cc(NCCCCCNS(=O)(=O)C(C)(C)C)cc2c1C(C)CC2.
What is the InChIKey of N-[5-[(1,7-dimethyl-2,3-dihydro-1H-inden-5-yl)amino]pentyl]-2-methylpropane-2-sulfonamide?
The InChIKey is MCUPTWISUGZLRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H34N2O2S/c1-15-9-10-17-14-18(13-16(2)19(15)17)21-11-7-6-8-12-22-25(23,24)20(3,4)5/h13-15,21-22H,6-12H2,1-5H3.
What are the key properties of N-[5-[(1,7-dimethyl-2,3-dihydro-1H-inden-5-yl)amino]pentyl]-2-methylpropane-2-sulfonamide?
N-[5-[(1,7-dimethyl-2,3-dihydro-1H-inden-5-yl)amino]pentyl]-2-methylpropane-2-sulfonamide has a molecular weight of 366.57 g/mol, XLogP of 4.34, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-[(1,7-dimethyl-2,3-dihydro-1H-inden-5-yl)amino]pentyl]-2-methylpropane-2-sulfonamide is sourced from PubChem (CID 70939258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).