About N-[5-[4-(furan-2-yl)-2,3-dimethylanilino]pentyl]propane-2-sulfonamide
N-[5-[4-(furan-2-yl)-2,3-dimethylanilino]pentyl]propane-2-sulfonamide (PubChem CID 70939264) has the molecular formula C20H30N2O3S
and a molecular weight of 378.54 g/mol. Its IUPAC name is N-[5-[4-(furan-2-yl)-2,3-dimethylanilino]pentyl]propane-2-sulfonamide.
Molecular Properties
| Compound Name | N-[5-[4-(furan-2-yl)-2,3-dimethylanilino]pentyl]propane-2-sulfonamide |
| PubChem CID | 70939264 |
| Molecular Formula | C20H30N2O3S |
| Molecular Weight | 378.54 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | N-[5-[4-(furan-2-yl)-2,3-dimethylanilino]pentyl]propane-2-sulfonamide |
| SMILES | Cc1c(NCCCCCNS(=O)(=O)C(C)C)ccc(-c2ccco2)c1C |
| InChI | InChI=1S/C20H30N2O3S/c1-15(2)26(23,24)22-13-7-5-6-12-21-19-11-10-18(16(3)17(19)4)20-9-8-14-25-20/h8-11,14-15,21-22H,5-7,12-13H2,1-4H3 |
| InChIKey | BJUFXQCOJBXUIY-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.54 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[5-[4-(furan-2-yl)-2,3-dimethylanilino]pentyl]propane-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-[4-(furan-2-yl)-2,3-dimethylanilino]pentyl]propane-2-sulfonamide?
The IUPAC name of N-[5-[4-(furan-2-yl)-2,3-dimethylanilino]pentyl]propane-2-sulfonamide (CID 70939264) is N-[5-[4-(furan-2-yl)-2,3-dimethylanilino]pentyl]propane-2-sulfonamide.
What is the SMILES notation for N-[5-[4-(furan-2-yl)-2,3-dimethylanilino]pentyl]propane-2-sulfonamide?
The canonical SMILES for N-[5-[4-(furan-2-yl)-2,3-dimethylanilino]pentyl]propane-2-sulfonamide is Cc1c(NCCCCCNS(=O)(=O)C(C)C)ccc(-c2ccco2)c1C.
What is the InChIKey of N-[5-[4-(furan-2-yl)-2,3-dimethylanilino]pentyl]propane-2-sulfonamide?
The InChIKey is BJUFXQCOJBXUIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H30N2O3S/c1-15(2)26(23,24)22-13-7-5-6-12-21-19-11-10-18(16(3)17(19)4)20-9-8-14-25-20/h8-11,14-15,21-22H,5-7,12-13H2,1-4H3.
What are the key properties of N-[5-[4-(furan-2-yl)-2,3-dimethylanilino]pentyl]propane-2-sulfonamide?
N-[5-[4-(furan-2-yl)-2,3-dimethylanilino]pentyl]propane-2-sulfonamide has a molecular weight of 378.54 g/mol, XLogP of 4.47, 10 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-[4-(furan-2-yl)-2,3-dimethylanilino]pentyl]propane-2-sulfonamide is sourced from PubChem (CID 70939264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).