C18H31N3O4S3 — CID 70939524
N-[5-[2-(4-hydroxy-3-methylsulfanyl-4,5,6,7-tetrahydro-2-benzothiophene-1-carbonyl)hydrazinyl]pentyl]propane-2-sulfonamide (PubChem CID 70939524) has the molecular formula C18H31N3O4S3 and a molecular weight of 449.66 g/mol. Its IUPAC name is N-[5-[2-(4-hydroxy-3-methylsulfanyl-4,5,6,7-tetrahydro-2-benzothiophene-1-carbonyl)hydrazinyl]pentyl]propane-2-sulfonamide.
| Compound Name | N-[5-[2-(4-hydroxy-3-methylsulfanyl-4,5,6,7-tetrahydro-2-benzothiophene-1-carbonyl)hydrazinyl]pentyl]propane-2-sulfonamide |
|---|---|
| PubChem CID | 70939524 |
| Molecular Formula | C18H31N3O4S3 |
| Molecular Weight | 449.66 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | N-[5-[2-(4-hydroxy-3-methylsulfanyl-4,5,6,7-tetrahydro-2-benzothiophene-1-carbonyl)hydrazinyl]pentyl]propane-2-sulfonamide |
| SMILES | CSc1sc(C(=O)NNCCCCCNS(=O)(=O)C(C)C)c2c1C(O)CCC2 |
| InChI | InChI=1S/C18H31N3O4S3/c1-12(2)28(24,25)20-11-6-4-5-10-19-21-17(23)16-13-8-7-9-14(22)15(13)18(26-3)27-16/h12,14,19-20,22H,4-11H2,1-3H3,(H,21,23) |
| InChIKey | DPPHXESTMKBPNS-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.66 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|