C20H14O4S2 — CID 70940434
6,11-dihydroxy-8,9-bis(methylsulfanyl)tetracene-5,12-dione (PubChem CID 70940434) has the molecular formula C20H14O4S2 and a molecular weight of 382.46 g/mol. Its IUPAC name is 6,11-dihydroxy-8,9-bis(methylsulfanyl)tetracene-5,12-dione.
| Compound Name | 6,11-dihydroxy-8,9-bis(methylsulfanyl)tetracene-5,12-dione |
|---|---|
| PubChem CID | 70940434 |
| Molecular Formula | C20H14O4S2 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.03 |
| IUPAC Name | 6,11-dihydroxy-8,9-bis(methylsulfanyl)tetracene-5,12-dione |
| SMILES | CSc1cc2c(O)c3c(c(O)c2cc1SC)C(=O)c1ccccc1C3=O |
| InChI | InChI=1S/C20H14O4S2/c1-25-13-7-11-12(8-14(13)26-2)20(24)16-15(19(11)23)17(21)9-5-3-4-6-10(9)18(16)22/h3-8,23-24H,1-2H3 |
| InChIKey | ITBOZTILBWQJQS-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|