About (2-oxo-1,3-dioxolan-4-yl)methyl N-(2-hydroxyethyl)carbamate
(2-oxo-1,3-dioxolan-4-yl)methyl N-(2-hydroxyethyl)carbamate (PubChem CID 70941581) has the molecular formula C7H11NO6
and a molecular weight of 205.17 g/mol. Its IUPAC name is (2-oxo-1,3-dioxolan-4-yl)methyl N-(2-hydroxyethyl)carbamate.
Molecular Properties
| Compound Name | (2-oxo-1,3-dioxolan-4-yl)methyl N-(2-hydroxyethyl)carbamate |
| PubChem CID | 70941581 |
| Molecular Formula | C7H11NO6 |
| Molecular Weight | 205.17 g/mol |
| Exact Mass | 205.06 |
| IUPAC Name | (2-oxo-1,3-dioxolan-4-yl)methyl N-(2-hydroxyethyl)carbamate |
| SMILES | O=C(NCCO)OCC1COC(=O)O1 |
| InChI | InChI=1S/C7H11NO6/c9-2-1-8-6(10)12-3-5-4-13-7(11)14-5/h5,9H,1-4H2,(H,8,10) |
| InChIKey | PZXPTSRJVHIZAR-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.17 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2-oxo-1,3-dioxolan-4-yl)methyl N-(2-hydroxyethyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxo-1,3-dioxolan-4-yl)methyl N-(2-hydroxyethyl)carbamate?
The IUPAC name of (2-oxo-1,3-dioxolan-4-yl)methyl N-(2-hydroxyethyl)carbamate (CID 70941581) is (2-oxo-1,3-dioxolan-4-yl)methyl N-(2-hydroxyethyl)carbamate.
What is the SMILES notation for (2-oxo-1,3-dioxolan-4-yl)methyl N-(2-hydroxyethyl)carbamate?
The canonical SMILES for (2-oxo-1,3-dioxolan-4-yl)methyl N-(2-hydroxyethyl)carbamate is O=C(NCCO)OCC1COC(=O)O1.
What is the InChIKey of (2-oxo-1,3-dioxolan-4-yl)methyl N-(2-hydroxyethyl)carbamate?
The InChIKey is PZXPTSRJVHIZAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO6/c9-2-1-8-6(10)12-3-5-4-13-7(11)14-5/h5,9H,1-4H2,(H,8,10).
What are the key properties of (2-oxo-1,3-dioxolan-4-yl)methyl N-(2-hydroxyethyl)carbamate?
(2-oxo-1,3-dioxolan-4-yl)methyl N-(2-hydroxyethyl)carbamate has a molecular weight of 205.17 g/mol, XLogP of -0.76, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxo-1,3-dioxolan-4-yl)methyl N-(2-hydroxyethyl)carbamate is sourced from PubChem (CID 70941581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).