C20H16N6O3S — CID 70942325
4-amino-8-(benzenesulfonyl)-12-(1-methylpyrazol-4-yl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-3-ol (PubChem CID 70942325) has the molecular formula C20H16N6O3S and a molecular weight of 420.45 g/mol. Its IUPAC name is 4-amino-8-(benzenesulfonyl)-12-(1-methylpyrazol-4-yl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-3-ol.
| Compound Name | 4-amino-8-(benzenesulfonyl)-12-(1-methylpyrazol-4-yl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-3-ol |
|---|---|
| PubChem CID | 70942325 |
| Molecular Formula | C20H16N6O3S |
| Molecular Weight | 420.45 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | 4-amino-8-(benzenesulfonyl)-12-(1-methylpyrazol-4-yl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-3-ol |
| SMILES | Cn1cc(-c2cnc3c(c2)c2c(O)c(N)ncc2n3S(=O)(=O)c2ccccc2)cn1 |
| InChI | InChI=1S/C20H16N6O3S/c1-25-11-13(9-24-25)12-7-15-17-16(10-22-19(21)18(17)27)26(20(15)23-8-12)30(28,29)14-5-3-2-4-6-14/h2-11,27H,1H3,(H2,21,22) |
| InChIKey | PMORKELPCWNGCR-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 128.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.45 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |