C14H12N6S — CID 70942336
12-[3-(aminomethyl)-1,2-thiazol-5-yl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-4-amine (PubChem CID 70942336) has the molecular formula C14H12N6S and a molecular weight of 296.36 g/mol. Its IUPAC name is 12-[3-(aminomethyl)-1,2-thiazol-5-yl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-4-amine.
| Compound Name | 12-[3-(aminomethyl)-1,2-thiazol-5-yl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-4-amine |
|---|---|
| PubChem CID | 70942336 |
| Molecular Formula | C14H12N6S |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 12-[3-(aminomethyl)-1,2-thiazol-5-yl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-4-amine |
| SMILES | NCc1cc(-c2cnc3[nH]c4cnc(N)cc4c3c2)sn1 |
| InChI | InChI=1S/C14H12N6S/c15-4-8-2-12(21-20-8)7-1-10-9-3-13(16)17-6-11(9)19-14(10)18-5-7/h1-3,5-6H,4,15H2,(H2,16,17)(H,18,19) |
| InChIKey | XSYXTRWOTGVUPI-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 106.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |