C17H11F3N4 — CID 70942381
12-[4-(trifluoromethyl)phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-4-amine (PubChem CID 70942381) has the molecular formula C17H11F3N4 and a molecular weight of 328.30 g/mol. Its IUPAC name is 12-[4-(trifluoromethyl)phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-4-amine.
| Compound Name | 12-[4-(trifluoromethyl)phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-4-amine |
|---|---|
| PubChem CID | 70942381 |
| Molecular Formula | C17H11F3N4 |
| Molecular Weight | 328.30 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 12-[4-(trifluoromethyl)phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-4-amine |
| SMILES | Nc1cc2c(cn1)[nH]c1ncc(-c3ccc(C(F)(F)F)cc3)cc12 |
| InChI | InChI=1S/C17H11F3N4/c18-17(19,20)11-3-1-9(2-4-11)10-5-13-12-6-15(21)22-8-14(12)24-16(13)23-7-10/h1-8H,(H2,21,22)(H,23,24) |
| InChIKey | QCWDEYUTNUYDJI-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.30 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |