C18H16N4 — CID 70942423
12-(4-ethylphenyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-4-amine (PubChem CID 70942423) has the molecular formula C18H16N4 and a molecular weight of 288.35 g/mol. Its IUPAC name is 12-(4-ethylphenyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-4-amine.
| Compound Name | 12-(4-ethylphenyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-4-amine |
|---|---|
| PubChem CID | 70942423 |
| Molecular Formula | C18H16N4 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 12-(4-ethylphenyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-4-amine |
| SMILES | CCc1ccc(-c2cnc3[nH]c4cnc(N)cc4c3c2)cc1 |
| InChI | InChI=1S/C18H16N4/c1-2-11-3-5-12(6-4-11)13-7-15-14-8-17(19)20-10-16(14)22-18(15)21-9-13/h3-10H,2H2,1H3,(H2,19,20)(H,21,22) |
| InChIKey | IMERDEPQFQSJCK-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |