C21H22N6O2 — CID 70942449
12-(5-methoxy-3-pyridinyl)-3-piperidin-4-yloxy-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-4-amine (PubChem CID 70942449) has the molecular formula C21H22N6O2 and a molecular weight of 390.45 g/mol. Its IUPAC name is 12-(5-methoxy-3-pyridinyl)-3-piperidin-4-yloxy-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-4-amine.
| Compound Name | 12-(5-methoxy-3-pyridinyl)-3-piperidin-4-yloxy-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-4-amine |
|---|---|
| PubChem CID | 70942449 |
| Molecular Formula | C21H22N6O2 |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 12-(5-methoxy-3-pyridinyl)-3-piperidin-4-yloxy-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-4-amine |
| SMILES | COc1cncc(-c2cnc3[nH]c4cnc(N)c(OC5CCNCC5)c4c3c2)c1 |
| InChI | InChI=1S/C21H22N6O2/c1-28-15-6-12(8-24-10-15)13-7-16-18-17(27-21(16)26-9-13)11-25-20(22)19(18)29-14-2-4-23-5-3-14/h6-11,14,23H,2-5H2,1H3,(H2,22,25)(H,26,27) |
| InChIKey | XTRGYTCFLXESGC-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 110.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |