C16H19N5 — CID 70942510
3-(piperidin-4-ylmethyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-4-amine (PubChem CID 70942510) has the molecular formula C16H19N5 and a molecular weight of 281.36 g/mol. Its IUPAC name is 3-(piperidin-4-ylmethyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-4-amine.
| Compound Name | 3-(piperidin-4-ylmethyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-4-amine |
|---|---|
| PubChem CID | 70942510 |
| Molecular Formula | C16H19N5 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 3-(piperidin-4-ylmethyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-4-amine |
| SMILES | Nc1ncc2[nH]c3ncccc3c2c1CC1CCNCC1 |
| InChI | InChI=1S/C16H19N5/c17-15-12(8-10-3-6-18-7-4-10)14-11-2-1-5-19-16(11)21-13(14)9-20-15/h1-2,5,9-10,18H,3-4,6-8H2,(H2,17,20)(H,19,21) |
| InChIKey | ZBFCISBWUYLICV-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |