C26H45N3O11 — CID 70942851
4-O-tert-butyl 1-O-[3-[3-butyl-5-(2-hydroxy-4,4-dimethylhexyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]-2-hydroxypropyl] 2,3-dihydroxybutanedioate (PubChem CID 70942851) has the molecular formula C26H45N3O11 and a molecular weight of 575.66 g/mol. Its IUPAC name is 4-O-tert-butyl 1-O-[3-[3-butyl-5-(2-hydroxy-4,4-dimethylhexyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]-2-hydroxypropyl] 2,3-dihydroxybutanedioate.
| Compound Name | 4-O-tert-butyl 1-O-[3-[3-butyl-5-(2-hydroxy-4,4-dimethylhexyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]-2-hydroxypropyl] 2,3-dihydroxybutanedioate |
|---|---|
| PubChem CID | 70942851 |
| Molecular Formula | C26H45N3O11 |
| Molecular Weight | 575.66 g/mol |
| Exact Mass | 575.31 |
| IUPAC Name | 4-O-tert-butyl 1-O-[3-[3-butyl-5-(2-hydroxy-4,4-dimethylhexyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]-2-hydroxypropyl] 2,3-dihydroxybutanedioate |
| SMILES | CCCCn1c(=O)n(CC(O)COC(=O)C(O)C(O)C(=O)OC(C)(C)C)c(=O)n(CC(O)CC(C)(C)CC)c1=O |
| InChI | InChI=1S/C26H45N3O11/c1-8-10-11-27-22(36)28(13-16(30)12-26(6,7)9-2)24(38)29(23(27)37)14-17(31)15-39-20(34)18(32)19(33)21(35)40-25(3,4)5/h16-19,30-33H,8-15H2,1-7H3 |
| InChIKey | WMTJUCOWVHQPIF-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 199.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.66 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |