C23H39N3O11 — CID 70942853
4-O-tert-butyl 1-O-[3-[3-(4-ethyl-2-hydroxy-4-methylhexyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]-2-hydroxypropyl] 2,3-dihydroxybutanedioate (PubChem CID 70942853) has the molecular formula C23H39N3O11 and a molecular weight of 533.58 g/mol. Its IUPAC name is 4-O-tert-butyl 1-O-[3-[3-(4-ethyl-2-hydroxy-4-methylhexyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]-2-hydroxypropyl] 2,3-dihydroxybutanedioate.
| Compound Name | 4-O-tert-butyl 1-O-[3-[3-(4-ethyl-2-hydroxy-4-methylhexyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]-2-hydroxypropyl] 2,3-dihydroxybutanedioate |
|---|---|
| PubChem CID | 70942853 |
| Molecular Formula | C23H39N3O11 |
| Molecular Weight | 533.58 g/mol |
| Exact Mass | 533.26 |
| IUPAC Name | 4-O-tert-butyl 1-O-[3-[3-(4-ethyl-2-hydroxy-4-methylhexyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]-2-hydroxypropyl] 2,3-dihydroxybutanedioate |
| SMILES | CCC(C)(CC)CC(O)Cn1c(=O)[nH]c(=O)n(CC(O)COC(=O)C(O)C(O)C(=O)OC(C)(C)C)c1=O |
| InChI | InChI=1S/C23H39N3O11/c1-7-23(6,8-2)9-13(27)10-25-19(33)24-20(34)26(21(25)35)11-14(28)12-36-17(31)15(29)16(30)18(32)37-22(3,4)5/h13-16,27-30H,7-12H2,1-6H3,(H,24,33,34) |
| InChIKey | MOWKYHZEBLOODP-UHFFFAOYSA-N |
| XLogP | -1.76 |
| TPSA | 210.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.58 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |