C14H29N — CID 70943103
5-ethyl-2,2,4,7,7-pentamethylazocane (PubChem CID 70943103) has the molecular formula C14H29N and a molecular weight of 211.39 g/mol. Its IUPAC name is 5-ethyl-2,2,4,7,7-pentamethylazocane.
| Compound Name | 5-ethyl-2,2,4,7,7-pentamethylazocane |
|---|---|
| PubChem CID | 70943103 |
| Molecular Formula | C14H29N |
| Molecular Weight | 211.39 g/mol |
| Exact Mass | 211.23 |
| IUPAC Name | 5-ethyl-2,2,4,7,7-pentamethylazocane |
| SMILES | CCC1CC(C)(C)CNC(C)(C)CC1C |
| InChI | InChI=1S/C14H29N/c1-7-12-9-13(3,4)10-15-14(5,6)8-11(12)2/h11-12,15H,7-10H2,1-6H3 |
| InChIKey | HTJGUKASNLFMDQ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.39 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |