About (2-fluoro-5-iodocyclohexa-1,5-dien-1-yl)-(1,2-thiazol-5-yl)methanol
(2-fluoro-5-iodocyclohexa-1,5-dien-1-yl)-(1,2-thiazol-5-yl)methanol (PubChem CID 70943225) has the molecular formula C10H9FINOS
and a molecular weight of 337.16 g/mol. Its IUPAC name is (2-fluoro-5-iodocyclohexa-1,5-dien-1-yl)-(1,2-thiazol-5-yl)methanol.
Molecular Properties
| Compound Name | (2-fluoro-5-iodocyclohexa-1,5-dien-1-yl)-(1,2-thiazol-5-yl)methanol |
| PubChem CID | 70943225 |
| Molecular Formula | C10H9FINOS |
| Molecular Weight | 337.16 g/mol |
| Exact Mass | 336.94 |
| IUPAC Name | (2-fluoro-5-iodocyclohexa-1,5-dien-1-yl)-(1,2-thiazol-5-yl)methanol |
| SMILES | OC(C1=C(F)CCC(I)=C1)c1ccns1 |
| InChI | InChI=1S/C10H9FINOS/c11-8-2-1-6(12)5-7(8)10(14)9-3-4-13-15-9/h3-5,10,14H,1-2H2 |
| InChIKey | RNKPVLNCYRYQKF-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.16 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (2-fluoro-5-iodocyclohexa-1,5-dien-1-yl)-(1,2-thiazol-5-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-fluoro-5-iodocyclohexa-1,5-dien-1-yl)-(1,2-thiazol-5-yl)methanol?
The IUPAC name of (2-fluoro-5-iodocyclohexa-1,5-dien-1-yl)-(1,2-thiazol-5-yl)methanol (CID 70943225) is (2-fluoro-5-iodocyclohexa-1,5-dien-1-yl)-(1,2-thiazol-5-yl)methanol.
What is the SMILES notation for (2-fluoro-5-iodocyclohexa-1,5-dien-1-yl)-(1,2-thiazol-5-yl)methanol?
The canonical SMILES for (2-fluoro-5-iodocyclohexa-1,5-dien-1-yl)-(1,2-thiazol-5-yl)methanol is OC(C1=C(F)CCC(I)=C1)c1ccns1.
What is the InChIKey of (2-fluoro-5-iodocyclohexa-1,5-dien-1-yl)-(1,2-thiazol-5-yl)methanol?
The InChIKey is RNKPVLNCYRYQKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9FINOS/c11-8-2-1-6(12)5-7(8)10(14)9-3-4-13-15-9/h3-5,10,14H,1-2H2.
What are the key properties of (2-fluoro-5-iodocyclohexa-1,5-dien-1-yl)-(1,2-thiazol-5-yl)methanol?
(2-fluoro-5-iodocyclohexa-1,5-dien-1-yl)-(1,2-thiazol-5-yl)methanol has a molecular weight of 337.16 g/mol, XLogP of 3.51, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-fluoro-5-iodocyclohexa-1,5-dien-1-yl)-(1,2-thiazol-5-yl)methanol is sourced from PubChem (CID 70943225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).