C24H30N2O4 — CID 70943688
2-(2,4-dihydroxy-5-propan-2-ylphenyl)-N-ethyl-1-[(4-methoxyphenyl)methyl]-2,3-dihydropyrrole-5-carboxamide (PubChem CID 70943688) has the molecular formula C24H30N2O4 and a molecular weight of 410.51 g/mol. Its IUPAC name is 2-(2,4-dihydroxy-5-propan-2-ylphenyl)-N-ethyl-1-[(4-methoxyphenyl)methyl]-2,3-dihydropyrrole-5-carboxamide.
| Compound Name | 2-(2,4-dihydroxy-5-propan-2-ylphenyl)-N-ethyl-1-[(4-methoxyphenyl)methyl]-2,3-dihydropyrrole-5-carboxamide |
|---|---|
| PubChem CID | 70943688 |
| Molecular Formula | C24H30N2O4 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | 2-(2,4-dihydroxy-5-propan-2-ylphenyl)-N-ethyl-1-[(4-methoxyphenyl)methyl]-2,3-dihydropyrrole-5-carboxamide |
| SMILES | CCNC(=O)C1=CCC(c2cc(C(C)C)c(O)cc2O)N1Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C24H30N2O4/c1-5-25-24(29)21-11-10-20(19-12-18(15(2)3)22(27)13-23(19)28)26(21)14-16-6-8-17(30-4)9-7-16/h6-9,11-13,15,20,27-28H,5,10,14H2,1-4H3,(H,25,29) |
| InChIKey | GGONQMZLSPSAMY-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|