C17H30N2O6 — CID 70943724
ethyl (1R,2R,3R,4R,5S)-4-acetamido-2-methyl-5-nitro-3-pentan-3-yloxycyclohexane-1-carboxylate (PubChem CID 70943724) has the molecular formula C17H30N2O6 and a molecular weight of 358.44 g/mol. Its IUPAC name is ethyl (1R,2R,3R,4R,5S)-4-acetamido-2-methyl-5-nitro-3-pentan-3-yloxycyclohexane-1-carboxylate.
| Compound Name | ethyl (1R,2R,3R,4R,5S)-4-acetamido-2-methyl-5-nitro-3-pentan-3-yloxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 70943724 |
| Molecular Formula | C17H30N2O6 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | ethyl (1R,2R,3R,4R,5S)-4-acetamido-2-methyl-5-nitro-3-pentan-3-yloxycyclohexane-1-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C[C@H]([N+](=O)[O-])[C@@H](NC(C)=O)[C@H](OC(CC)CC)[C@@H]1C |
| InChI | InChI=1S/C17H30N2O6/c1-6-12(7-2)25-16-10(4)13(17(21)24-8-3)9-14(19(22)23)15(16)18-11(5)20/h10,12-16H,6-9H2,1-5H3,(H,18,20)/t10-,13-,14+,15-,16-/m1/s1 |
| InChIKey | WQENZFKEOMIERS-LMXXTMHSSA-N |
| XLogP | 1.93 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|