C14H24N2O — CID 70944514
[(3aR,6aS)-5-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-piperidin-1-ylmethanone (PubChem CID 70944514) has the molecular formula C14H24N2O and a molecular weight of 236.36 g/mol. Its IUPAC name is [(3aR,6aS)-5-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-piperidin-1-ylmethanone.
| Compound Name | [(3aR,6aS)-5-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 70944514 |
| Molecular Formula | C14H24N2O |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | [(3aR,6aS)-5-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-piperidin-1-ylmethanone |
| SMILES | CC1C[C@@H]2CN(C(=O)N3CCCCC3)C[C@@H]2C1 |
| InChI | InChI=1S/C14H24N2O/c1-11-7-12-9-16(10-13(12)8-11)14(17)15-5-3-2-4-6-15/h11-13H,2-10H2,1H3/t11?,12-,13+ |
| InChIKey | CJBXTSUCTRHLAM-YHWZYXNKSA-N |
| XLogP | 2.57 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |