About 3-[3-(trifluoromethyl)cyclohepta-1,4,6-trien-1-yl]pyrrolidine
3-[3-(trifluoromethyl)cyclohepta-1,4,6-trien-1-yl]pyrrolidine (PubChem CID 70944553) has the molecular formula C12H14F3N
and a molecular weight of 229.25 g/mol. Its IUPAC name is 3-[3-(trifluoromethyl)cyclohepta-1,4,6-trien-1-yl]pyrrolidine.
Molecular Properties
| Compound Name | 3-[3-(trifluoromethyl)cyclohepta-1,4,6-trien-1-yl]pyrrolidine |
| PubChem CID | 70944553 |
| Molecular Formula | C12H14F3N |
| Molecular Weight | 229.25 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 3-[3-(trifluoromethyl)cyclohepta-1,4,6-trien-1-yl]pyrrolidine |
| SMILES | FC(F)(F)C1C=CC=CC(C2CCNC2)=C1 |
| InChI | InChI=1S/C12H14F3N/c13-12(14,15)11-4-2-1-3-9(7-11)10-5-6-16-8-10/h1-4,7,10-11,16H,5-6,8H2 |
| InChIKey | FHKOEAHNRLIKDX-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.25 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-[3-(trifluoromethyl)cyclohepta-1,4,6-trien-1-yl]pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(trifluoromethyl)cyclohepta-1,4,6-trien-1-yl]pyrrolidine?
The IUPAC name of 3-[3-(trifluoromethyl)cyclohepta-1,4,6-trien-1-yl]pyrrolidine (CID 70944553) is 3-[3-(trifluoromethyl)cyclohepta-1,4,6-trien-1-yl]pyrrolidine.
What is the SMILES notation for 3-[3-(trifluoromethyl)cyclohepta-1,4,6-trien-1-yl]pyrrolidine?
The canonical SMILES for 3-[3-(trifluoromethyl)cyclohepta-1,4,6-trien-1-yl]pyrrolidine is FC(F)(F)C1C=CC=CC(C2CCNC2)=C1.
What is the InChIKey of 3-[3-(trifluoromethyl)cyclohepta-1,4,6-trien-1-yl]pyrrolidine?
The InChIKey is FHKOEAHNRLIKDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14F3N/c13-12(14,15)11-4-2-1-3-9(7-11)10-5-6-16-8-10/h1-4,7,10-11,16H,5-6,8H2.
What are the key properties of 3-[3-(trifluoromethyl)cyclohepta-1,4,6-trien-1-yl]pyrrolidine?
3-[3-(trifluoromethyl)cyclohepta-1,4,6-trien-1-yl]pyrrolidine has a molecular weight of 229.25 g/mol, XLogP of 2.83, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(trifluoromethyl)cyclohepta-1,4,6-trien-1-yl]pyrrolidine is sourced from PubChem (CID 70944553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).