About [4-(5-bromothieno[2,3-d]pyrimidin-4-yl)oxycyclohexyl]-methylcarbamic acid
[4-(5-bromothieno[2,3-d]pyrimidin-4-yl)oxycyclohexyl]-methylcarbamic acid (PubChem CID 70944966) has the molecular formula C14H16BrN3O3S
and a molecular weight of 386.27 g/mol. Its IUPAC name is [4-(5-bromothieno[2,3-d]pyrimidin-4-yl)oxycyclohexyl]-methylcarbamic acid.
Molecular Properties
| Compound Name | [4-(5-bromothieno[2,3-d]pyrimidin-4-yl)oxycyclohexyl]-methylcarbamic acid |
| PubChem CID | 70944966 |
| Molecular Formula | C14H16BrN3O3S |
| Molecular Weight | 386.27 g/mol |
| Exact Mass | 385.01 |
| IUPAC Name | [4-(5-bromothieno[2,3-d]pyrimidin-4-yl)oxycyclohexyl]-methylcarbamic acid |
| SMILES | CN(C(=O)O)C1CCC(Oc2ncnc3scc(Br)c23)CC1 |
| InChI | InChI=1S/C14H16BrN3O3S/c1-18(14(19)20)8-2-4-9(5-3-8)21-12-11-10(15)6-22-13(11)17-7-16-12/h6-9H,2-5H2,1H3,(H,19,20) |
| InChIKey | YXDQANSDIFVWJP-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.27 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4-(5-bromothieno[2,3-d]pyrimidin-4-yl)oxycyclohexyl]-methylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(5-bromothieno[2,3-d]pyrimidin-4-yl)oxycyclohexyl]-methylcarbamic acid?
The IUPAC name of [4-(5-bromothieno[2,3-d]pyrimidin-4-yl)oxycyclohexyl]-methylcarbamic acid (CID 70944966) is [4-(5-bromothieno[2,3-d]pyrimidin-4-yl)oxycyclohexyl]-methylcarbamic acid.
What is the SMILES notation for [4-(5-bromothieno[2,3-d]pyrimidin-4-yl)oxycyclohexyl]-methylcarbamic acid?
The canonical SMILES for [4-(5-bromothieno[2,3-d]pyrimidin-4-yl)oxycyclohexyl]-methylcarbamic acid is CN(C(=O)O)C1CCC(Oc2ncnc3scc(Br)c23)CC1.
What is the InChIKey of [4-(5-bromothieno[2,3-d]pyrimidin-4-yl)oxycyclohexyl]-methylcarbamic acid?
The InChIKey is YXDQANSDIFVWJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16BrN3O3S/c1-18(14(19)20)8-2-4-9(5-3-8)21-12-11-10(15)6-22-13(11)17-7-16-12/h6-9H,2-5H2,1H3,(H,19,20).
What are the key properties of [4-(5-bromothieno[2,3-d]pyrimidin-4-yl)oxycyclohexyl]-methylcarbamic acid?
[4-(5-bromothieno[2,3-d]pyrimidin-4-yl)oxycyclohexyl]-methylcarbamic acid has a molecular weight of 386.27 g/mol, XLogP of 3.75, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(5-bromothieno[2,3-d]pyrimidin-4-yl)oxycyclohexyl]-methylcarbamic acid is sourced from PubChem (CID 70944966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).