C16H12ClIN2O2 — CID 70944996
(3R)-9-chloro-3-[(4-iodophenyl)methyl]-3,4-dihydro-1H-1,4-benzodiazepine-2,5-dione (PubChem CID 70944996) has the molecular formula C16H12ClIN2O2 and a molecular weight of 426.64 g/mol. Its IUPAC name is (3R)-9-chloro-3-[(4-iodophenyl)methyl]-3,4-dihydro-1H-1,4-benzodiazepine-2,5-dione.
| Compound Name | (3R)-9-chloro-3-[(4-iodophenyl)methyl]-3,4-dihydro-1H-1,4-benzodiazepine-2,5-dione |
|---|---|
| PubChem CID | 70944996 |
| Molecular Formula | C16H12ClIN2O2 |
| Molecular Weight | 426.64 g/mol |
| Exact Mass | 425.96 |
| IUPAC Name | (3R)-9-chloro-3-[(4-iodophenyl)methyl]-3,4-dihydro-1H-1,4-benzodiazepine-2,5-dione |
| SMILES | O=C1N[C@H](Cc2ccc(I)cc2)C(=O)Nc2c(Cl)cccc21 |
| InChI | InChI=1S/C16H12ClIN2O2/c17-12-3-1-2-11-14(12)20-16(22)13(19-15(11)21)8-9-4-6-10(18)7-5-9/h1-7,13H,8H2,(H,19,21)(H,20,22)/t13-/m1/s1 |
| InChIKey | NUSTXSFSRVGTAD-CYBMUJFWSA-N |
| XLogP | 3.24 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.64 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|