C10H19N3O5S — CID 70945570
4-(4-acetylpiperazin-1-yl)sulfonyl-2-aminobutanoic acid (PubChem CID 70945570) has the molecular formula C10H19N3O5S and a molecular weight of 293.34 g/mol. Its IUPAC name is 4-(4-acetylpiperazin-1-yl)sulfonyl-2-aminobutanoic acid.
| Compound Name | 4-(4-acetylpiperazin-1-yl)sulfonyl-2-aminobutanoic acid |
|---|---|
| PubChem CID | 70945570 |
| Molecular Formula | C10H19N3O5S |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 4-(4-acetylpiperazin-1-yl)sulfonyl-2-aminobutanoic acid |
| SMILES | CC(=O)N1CCN(S(=O)(=O)CCC(N)C(=O)O)CC1 |
| InChI | InChI=1S/C10H19N3O5S/c1-8(14)12-3-5-13(6-4-12)19(17,18)7-2-9(11)10(15)16/h9H,2-7,11H2,1H3,(H,15,16) |
| InChIKey | VAQRFBJQCFGFNU-UHFFFAOYSA-N |
| XLogP | -1.72 |
| TPSA | 121.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |