C13H18O4S — CID 70946008
2,3-dihydrothieno[3,4-b][1,4]dioxine;methyl 2,3-dimethylbut-2-enoate (PubChem CID 70946008) has the molecular formula C13H18O4S and a molecular weight of 270.35 g/mol. Its IUPAC name is 2,3-dihydrothieno[3,4-b][1,4]dioxine;methyl 2,3-dimethylbut-2-enoate.
| Compound Name | 2,3-dihydrothieno[3,4-b][1,4]dioxine;methyl 2,3-dimethylbut-2-enoate |
|---|---|
| PubChem CID | 70946008 |
| Molecular Formula | C13H18O4S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 2,3-dihydrothieno[3,4-b][1,4]dioxine;methyl 2,3-dimethylbut-2-enoate |
| SMILES | COC(=O)C(C)=C(C)C.c1scc2c1OCCO2 |
| InChI | InChI=1S/C7H12O2.C6H6O2S/c1-5(2)6(3)7(8)9-4;1-2-8-6-4-9-3-5(6)7-1/h1-4H3;3-4H,1-2H2 |
| InChIKey | QBQMAAQPKIBGIB-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|